C9H13N3OS2 — CID 2111712
trans-(1S,2S)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-methylcyclopropane-1-carboxamide (PubChem CID 2111712) has the molecular formula C9H13N3OS2 and a molecular weight of 243.36 g/mol. Its IUPAC name is trans-(1S,2S)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-methylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 2111712 |
| Molecular Formula | C9H13N3OS2 |
| Molecular Weight | 243.36 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | trans-(1S,2S)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-methylcyclopropane-1-carboxamide |
| SMILES | CCSc1nnc(NC(=O)[C@H]2C[C@@H]2C)s1 |
| InChI | InChI=1S/C9H13N3OS2/c1-3-14-9-12-11-8(15-9)10-7(13)6-4-5(6)2/h5-6H,3-4H2,1-2H3,(H,10,11,13)/t5-,6-/m0/s1 |
| InChIKey | BLVUYYRLEVJVSH-WDSKDSINSA-N |
| XLogP | 2.24 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|