C12H17N3OS2 — CID 6974884
(1S,2R,4S)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 6974884) has the molecular formula C12H17N3OS2 and a molecular weight of 283.42 g/mol. Its IUPAC name is (1S,2R,4S)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2R,4S)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 6974884 |
| Molecular Formula | C12H17N3OS2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (1S,2R,4S)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CCSc1nnc(NC(=O)[C@@H]2C[C@H]3CC[C@H]2C3)s1 |
| InChI | InChI=1S/C12H17N3OS2/c1-2-17-12-15-14-11(18-12)13-10(16)9-6-7-3-4-8(9)5-7/h7-9H,2-6H2,1H3,(H,13,14,16)/t7-,8-,9+/m0/s1 |
| InChIKey | GOJANEFCFSLCMR-XHNCKOQMSA-N |
| XLogP | 3.02 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|