C12H16N3O3S2- — CID 6937198
trans-(1S,2S)-2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)carbamoyl]cyclohexane-1-carboxylate (PubChem CID 6937198) has the molecular formula C12H16N3O3S2- and a molecular weight of 314.41 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | trans-(1S,2S)-2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6937198 |
| Molecular Formula | C12H16N3O3S2- |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | trans-(1S,2S)-2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)carbamoyl]cyclohexane-1-carboxylate |
| SMILES | CCSc1nnc(NC(=O)[C@H]2CCCC[C@@H]2C(=O)[O-])s1 |
| InChI | InChI=1S/C12H17N3O3S2/c1-2-19-12-15-14-11(20-12)13-9(16)7-5-3-4-6-8(7)10(17)18/h7-8H,2-6H2,1H3,(H,17,18)(H,13,14,16)/p-1/t7-,8-/m0/s1 |
| InChIKey | BNSAWHKPOCOZKJ-YUMQZZPRSA-M |
| XLogP | 1.14 |
| TPSA | 95.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|