C7H12N4OS2 — CID 154417531
3-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1,1-dimethylurea (PubChem CID 154417531) has the molecular formula C7H12N4OS2 and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1,1-dimethylurea.
| Compound Name | 3-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 154417531 |
| Molecular Formula | C7H12N4OS2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 3-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1,1-dimethylurea |
| SMILES | CCSc1nnc(NC(=O)N(C)C)s1 |
| InChI | InChI=1S/C7H12N4OS2/c1-4-13-7-10-9-5(14-7)8-6(12)11(2)3/h4H2,1-3H3,(H,8,9,12) |
| InChIKey | GARHMFKENWNGGC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|