C8H14N4OS2 — CID 91995911
1,1-dimethyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 91995911) has the molecular formula C8H14N4OS2 and a molecular weight of 246.36 g/mol. Its IUPAC name is 1,1-dimethyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1,1-dimethyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 91995911 |
| Molecular Formula | C8H14N4OS2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 1,1-dimethyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCCSc1nnc(NC(=O)N(C)C)s1 |
| InChI | InChI=1S/C8H14N4OS2/c1-4-5-14-8-11-10-6(15-8)9-7(13)12(2)3/h4-5H2,1-3H3,(H,9,10,13) |
| InChIKey | HNNGQWJQWDCSIV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|