C12H20N4OS2 — CID 18578423
1-cyclohexyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 18578423) has the molecular formula C12H20N4OS2 and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-cyclohexyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 18578423 |
| Molecular Formula | C12H20N4OS2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-cyclohexyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCCSc1nnc(NC(=O)NC2CCCCC2)s1 |
| InChI | InChI=1S/C12H20N4OS2/c1-2-8-18-12-16-15-11(19-12)14-10(17)13-9-6-4-3-5-7-9/h9H,2-8H2,1H3,(H2,13,14,15,17) |
| InChIKey | BGVFIWKDVWTEIR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|