C15H23N5O3S2 — CID 7587202
(2S)-2-[[5-(cyclohexylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N,N-dimethyl-3-oxobutanamide (PubChem CID 7587202) has the molecular formula C15H23N5O3S2 and a molecular weight of 385.52 g/mol. Its IUPAC name is (2S)-2-[[5-(cyclohexylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N,N-dimethyl-3-oxobutanamide.
| Compound Name | (2S)-2-[[5-(cyclohexylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N,N-dimethyl-3-oxobutanamide |
|---|---|
| PubChem CID | 7587202 |
| Molecular Formula | C15H23N5O3S2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (2S)-2-[[5-(cyclohexylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N,N-dimethyl-3-oxobutanamide |
| SMILES | CC(=O)[C@H](Sc1nnc(NC(=O)NC2CCCCC2)s1)C(=O)N(C)C |
| InChI | InChI=1S/C15H23N5O3S2/c1-9(21)11(12(22)20(2)3)24-15-19-18-14(25-15)17-13(23)16-10-7-5-4-6-8-10/h10-11H,4-8H2,1-3H3,(H2,16,17,18,23)/t11-/m0/s1 |
| InChIKey | WEQLOXZDMIJVMG-NSHDSACASA-N |
| XLogP | 2.13 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|