C10H16N4OS — CID 47191642
1-cycloheptyl-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 47191642) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 1-cycloheptyl-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-cycloheptyl-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 47191642 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-cycloheptyl-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | O=C(Nc1nncs1)NC1CCCCCC1 |
| InChI | InChI=1S/C10H16N4OS/c15-9(13-10-14-11-7-16-10)12-8-5-3-1-2-4-6-8/h7-8H,1-6H2,(H2,12,13,14,15) |
| InChIKey | NFHXIKCIIWWCHZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |