C11H17N5OS — CID 100839972
1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 100839972) has the molecular formula C11H17N5OS and a molecular weight of 267.36 g/mol. Its IUPAC name is 1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 100839972 |
| Molecular Formula | C11H17N5OS |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | O=C(Nc1nncs1)N[C@@H]1CCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C11H17N5OS/c17-10(14-11-15-12-7-18-11)13-8-4-6-16-5-2-1-3-9(8)16/h7-9H,1-6H2,(H2,13,14,15,17)/t8-,9+/m1/s1 |
| InChIKey | JMYMKPKCLIALNZ-BDAKNGLRSA-N |
| XLogP | 1.29 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |