C19H29N5O — CID 100852720
1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(6-piperidin-1-yl-3-pyridinyl)urea (PubChem CID 100852720) has the molecular formula C19H29N5O and a molecular weight of 343.48 g/mol. Its IUPAC name is 1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(6-piperidin-1-yl-3-pyridinyl)urea.
| Compound Name | 1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(6-piperidin-1-yl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 100852720 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(6-piperidin-1-yl-3-pyridinyl)urea |
| SMILES | O=C(Nc1ccc(N2CCCCC2)nc1)N[C@H]1CCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C19H29N5O/c25-19(22-16-9-13-23-10-5-2-6-17(16)23)21-15-7-8-18(20-14-15)24-11-3-1-4-12-24/h7-8,14,16-17H,1-6,9-13H2,(H2,21,22,25)/t16-,17-/m0/s1 |
| InChIKey | UADOYXJGMLVWAT-IRXDYDNUSA-N |
| XLogP | 2.82 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |