About 1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea
1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea (PubChem CID 94991579) has the molecular formula C19H21FN4O
and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea.
Molecular Properties
| Compound Name | 1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea |
| PubChem CID | 94991579 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea |
| SMILES | O=C(Nc1ccc(N2CCCC2)nc1)N[C@H]1C[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C19H21FN4O/c20-14-5-3-4-13(10-14)16-11-17(16)23-19(25)22-15-6-7-18(21-12-15)24-8-1-2-9-24/h3-7,10,12,16-17H,1-2,8-9,11H2,(H2,22,23,25)/t16-,17-/m0/s1 |
| InChIKey | KRNSVEFDYAKLNK-IRXDYDNUSA-N |
| XLogP | 3.50 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea?
The IUPAC name of 1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea (CID 94991579) is 1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea.
What is the SMILES notation for 1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea?
The canonical SMILES for 1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea is O=C(Nc1ccc(N2CCCC2)nc1)N[C@H]1C[C@H]1c1cccc(F)c1.
What is the InChIKey of 1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea?
The InChIKey is KRNSVEFDYAKLNK-IRXDYDNUSA-N. The full InChI is InChI=1S/C19H21FN4O/c20-14-5-3-4-13(10-14)16-11-17(16)23-19(25)22-15-6-7-18(21-12-15)24-8-1-2-9-24/h3-7,10,12,16-17H,1-2,8-9,11H2,(H2,22,23,25)/t16-,17-/m0/s1.
What are the key properties of 1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea?
1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea has a molecular weight of 340.40 g/mol, XLogP of 3.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-3-(6-pyrrolidin-1-yl-3-pyridinyl)urea is sourced from PubChem (CID 94991579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).