C19H22ClN5O — CID 113014392
1-[6-[4-(3-chlorophenyl)piperazin-1-yl]-3-pyridinyl]-3-cyclopropylurea (PubChem CID 113014392) has the molecular formula C19H22ClN5O and a molecular weight of 371.87 g/mol. Its IUPAC name is 1-[6-[4-(3-chlorophenyl)piperazin-1-yl]-3-pyridinyl]-3-cyclopropylurea.
| Compound Name | 1-[6-[4-(3-chlorophenyl)piperazin-1-yl]-3-pyridinyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 113014392 |
| Molecular Formula | C19H22ClN5O |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-[6-[4-(3-chlorophenyl)piperazin-1-yl]-3-pyridinyl]-3-cyclopropylurea |
| SMILES | O=C(Nc1ccc(N2CCN(c3cccc(Cl)c3)CC2)nc1)NC1CC1 |
| InChI | InChI=1S/C19H22ClN5O/c20-14-2-1-3-17(12-14)24-8-10-25(11-9-24)18-7-6-16(13-21-18)23-19(26)22-15-4-5-15/h1-3,6-7,12-13,15H,4-5,8-11H2,(H2,22,23,26) |
| InChIKey | BOLRFSFHHVRDKQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |