C18H20N4O — CID 113013160
1-cyclopropyl-3-[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]urea (PubChem CID 113013160) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-cyclopropyl-3-[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]urea.
| Compound Name | 1-cyclopropyl-3-[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 113013160 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-cyclopropyl-3-[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]urea |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc3C2)nc1)NC1CC1 |
| InChI | InChI=1S/C18H20N4O/c23-18(20-15-5-6-15)21-16-7-8-17(19-11-16)22-10-9-13-3-1-2-4-14(13)12-22/h1-4,7-8,11,15H,5-6,9-10,12H2,(H2,20,21,23) |
| InChIKey | CIPPCNPJCPXQSO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |