C26H32N4O2 — CID 1067428
5-(cyclohexylcarbamoylamino)-N-cyclopropyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide (PubChem CID 1067428) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 5-(cyclohexylcarbamoylamino)-N-cyclopropyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide.
| Compound Name | 5-(cyclohexylcarbamoylamino)-N-cyclopropyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide |
|---|---|
| PubChem CID | 1067428 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 5-(cyclohexylcarbamoylamino)-N-cyclopropyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NC2CC2)c1)NC1CCCCC1 |
| InChI | InChI=1S/C26H32N4O2/c31-25(27-21-10-11-21)23-16-22(29-26(32)28-20-8-2-1-3-9-20)12-13-24(23)30-15-14-18-6-4-5-7-19(18)17-30/h4-7,12-13,16,20-21H,1-3,8-11,14-15,17H2,(H,27,31)(H2,28,29,32) |
| InChIKey | MFRFWEZZZFWKLS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|