C31H36N4O4 — CID 42753033
N-cyclohexyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2,4-dimethoxyphenyl)carbamoylamino]benzamide (PubChem CID 42753033) has the molecular formula C31H36N4O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2,4-dimethoxyphenyl)carbamoylamino]benzamide.
| Compound Name | N-cyclohexyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2,4-dimethoxyphenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 42753033 |
| Molecular Formula | C31H36N4O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | N-cyclohexyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2,4-dimethoxyphenyl)carbamoylamino]benzamide |
| SMILES | COc1ccc(NC(=O)Nc2ccc(N3CCc4ccccc4C3)c(C(=O)NC3CCCCC3)c2)c(OC)c1 |
| InChI | InChI=1S/C31H36N4O4/c1-38-25-13-14-27(29(19-25)39-2)34-31(37)33-24-12-15-28(35-17-16-21-8-6-7-9-22(21)20-35)26(18-24)30(36)32-23-10-4-3-5-11-23/h6-9,12-15,18-19,23H,3-5,10-11,16-17,20H2,1-2H3,(H,32,36)(H2,33,34,37) |
| InChIKey | HIQNOSBFYZMUPI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|