C26H31N3O2 — CID 42752860
N-cyclohexyl-5-(cyclopropanecarbonylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide (PubChem CID 42752860) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-cyclohexyl-5-(cyclopropanecarbonylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide.
| Compound Name | N-cyclohexyl-5-(cyclopropanecarbonylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide |
|---|---|
| PubChem CID | 42752860 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-cyclohexyl-5-(cyclopropanecarbonylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide |
| SMILES | O=C(NC1CCCCC1)c1cc(NC(=O)C2CC2)ccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C26H31N3O2/c30-25(19-10-11-19)28-22-12-13-24(29-15-14-18-6-4-5-7-20(18)17-29)23(16-22)26(31)27-21-8-2-1-3-9-21/h4-7,12-13,16,19,21H,1-3,8-11,14-15,17H2,(H,27,31)(H,28,30) |
| InChIKey | KDRFZWKRYFFDIJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|