C27H29N3O3 — CID 42752862
N-[3-(cyclohexylcarbamoyl)-4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]furan-2-carboxamide (PubChem CID 42752862) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[3-(cyclohexylcarbamoyl)-4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-(cyclohexylcarbamoyl)-4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42752862 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-[3-(cyclohexylcarbamoyl)-4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NC2CCCCC2)c1)c1ccco1 |
| InChI | InChI=1S/C27H29N3O3/c31-26(28-21-9-2-1-3-10-21)23-17-22(29-27(32)25-11-6-16-33-25)12-13-24(23)30-15-14-19-7-4-5-8-20(19)18-30/h4-8,11-13,16-17,21H,1-3,9-10,14-15,18H2,(H,28,31)(H,29,32) |
| InChIKey | OFAHDBIYPKFJSR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|