C22H25N3O2 — CID 1066606
N-cyclopropyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(propanoylamino)benzamide (PubChem CID 1066606) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-cyclopropyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(propanoylamino)benzamide.
| Compound Name | N-cyclopropyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 1066606 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-cyclopropyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C22H25N3O2/c1-2-21(26)23-18-9-10-20(19(13-18)22(27)24-17-7-8-17)25-12-11-15-5-3-4-6-16(15)14-25/h3-6,9-10,13,17H,2,7-8,11-12,14H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | ODANINMYWXUXDC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|