C24H30N4O2 — CID 3608965
5-(butylcarbamoylamino)-N-cyclopropyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide (PubChem CID 3608965) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 5-(butylcarbamoylamino)-N-cyclopropyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide.
| Compound Name | 5-(butylcarbamoylamino)-N-cyclopropyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide |
|---|---|
| PubChem CID | 3608965 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 5-(butylcarbamoylamino)-N-cyclopropyl-2-(3,4-dihydro-1H-isoquinolin-2-yl)benzamide |
| SMILES | CCCCNC(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C24H30N4O2/c1-2-3-13-25-24(30)27-20-10-11-22(21(15-20)23(29)26-19-8-9-19)28-14-12-17-6-4-5-7-18(17)16-28/h4-7,10-11,15,19H,2-3,8-9,12-14,16H2,1H3,(H,26,29)(H2,25,27,30) |
| InChIKey | XWYPLEWOQJYTPD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|