C27H37N3O3 — CID 4233840
2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(3,3-dimethylbutanoylamino)-N-(3-ethoxypropyl)benzamide (PubChem CID 4233840) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(3,3-dimethylbutanoylamino)-N-(3-ethoxypropyl)benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(3,3-dimethylbutanoylamino)-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 4233840 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(3,3-dimethylbutanoylamino)-N-(3-ethoxypropyl)benzamide |
| SMILES | CCOCCCNC(=O)c1cc(NC(=O)CC(C)(C)C)ccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C27H37N3O3/c1-5-33-16-8-14-28-26(32)23-17-22(29-25(31)18-27(2,3)4)11-12-24(23)30-15-13-20-9-6-7-10-21(20)19-30/h6-7,9-12,17H,5,8,13-16,18-19H2,1-4H3,(H,28,32)(H,29,31) |
| InChIKey | AFZRERFDOXOWRC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|