C24H29N3O2 — CID 1064478
5-benzamido-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide (PubChem CID 1064478) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is 5-benzamido-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-benzamido-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1064478 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 5-benzamido-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(C(=O)NC2CCCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H29N3O2/c28-23(18-9-3-1-4-10-18)26-20-13-14-22(27-15-7-8-16-27)21(17-20)24(29)25-19-11-5-2-6-12-19/h1,3-4,9-10,13-14,17,19H,2,5-8,11-12,15-16H2,(H,25,29)(H,26,28) |
| InChIKey | WICPMRSOEACZRV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|