C29H31N3O2 — CID 4645895
N-cyclopropyl-2-(4-methylpiperidin-1-yl)-5-[(4-phenylbenzoyl)amino]benzamide (PubChem CID 4645895) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is N-cyclopropyl-2-(4-methylpiperidin-1-yl)-5-[(4-phenylbenzoyl)amino]benzamide.
| Compound Name | N-cyclopropyl-2-(4-methylpiperidin-1-yl)-5-[(4-phenylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 4645895 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | N-cyclopropyl-2-(4-methylpiperidin-1-yl)-5-[(4-phenylbenzoyl)amino]benzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)c3ccc(-c4ccccc4)cc3)cc2C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C29H31N3O2/c1-20-15-17-32(18-16-20)27-14-13-25(19-26(27)29(34)30-24-11-12-24)31-28(33)23-9-7-22(8-10-23)21-5-3-2-4-6-21/h2-10,13-14,19-20,24H,11-12,15-18H2,1H3,(H,30,34)(H,31,33) |
| InChIKey | VRIOWEFMBJUAJA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|