C25H32N4O2 — CID 1067391
N-cyclopropyl-5-[(2,6-dimethylphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 1067391) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-cyclopropyl-5-[(2,6-dimethylphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | N-cyclopropyl-5-[(2,6-dimethylphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 1067391 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | N-cyclopropyl-5-[(2,6-dimethylphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | Cc1cccc(C)c1NC(=O)Nc1ccc(N2CCC(C)CC2)c(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C25H32N4O2/c1-16-11-13-29(14-12-16)22-10-9-20(15-21(22)24(30)26-19-7-8-19)27-25(31)28-23-17(2)5-4-6-18(23)3/h4-6,9-10,15-16,19H,7-8,11-14H2,1-3H3,(H,26,30)(H2,27,28,31) |
| InChIKey | FHORSTSQAKFNAA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|