C22H26N4O3 — CID 1065604
N-cyclopropyl-5-[(4-methoxyphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide (PubChem CID 1065604) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-cyclopropyl-5-[(4-methoxyphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-cyclopropyl-5-[(4-methoxyphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1065604 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-cyclopropyl-5-[(4-methoxyphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide |
| SMILES | COc1ccc(NC(=O)Nc2ccc(N3CCCC3)c(C(=O)NC3CC3)c2)cc1 |
| InChI | InChI=1S/C22H26N4O3/c1-29-18-9-6-16(7-10-18)24-22(28)25-17-8-11-20(26-12-2-3-13-26)19(14-17)21(27)23-15-4-5-15/h6-11,14-15H,2-5,12-13H2,1H3,(H,23,27)(H2,24,25,28) |
| InChIKey | LHYJONOUILXIPV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|