C26H27F6N3O2 — CID 3950212
5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide (PubChem CID 3950212) has the molecular formula C26H27F6N3O2 and a molecular weight of 527.51 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3950212 |
| Molecular Formula | C26H27F6N3O2 |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(C(=O)NC2CCCCC2)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H27F6N3O2/c27-25(28,29)17-12-16(13-18(14-17)26(30,31)32)23(36)34-20-8-9-22(35-10-4-5-11-35)21(15-20)24(37)33-19-6-2-1-3-7-19/h8-9,12-15,19H,1-7,10-11H2,(H,33,37)(H,34,36) |
| InChIKey | QYQKAOWXZKMZRA-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|