C28H36N4O3 — CID 42751376
5-(cyclopentanecarbonylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 42751376) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is 5-(cyclopentanecarbonylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 5-(cyclopentanecarbonylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 42751376 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 5-(cyclopentanecarbonylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | O=C(NCCN1CCOCC1)c1cc(NC(=O)C2CCCC2)ccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C28H36N4O3/c33-27(22-6-2-3-7-22)30-24-9-10-26(32-13-11-21-5-1-4-8-23(21)20-32)25(19-24)28(34)29-12-14-31-15-17-35-18-16-31/h1,4-5,8-10,19,22H,2-3,6-7,11-18,20H2,(H,29,34)(H,30,33) |
| InChIKey | UWSMDPUZTNAUQA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|