C21H18ClN3O — CID 113013137
2-chloro-N-[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]benzamide (PubChem CID 113013137) has the molecular formula C21H18ClN3O and a molecular weight of 363.85 g/mol. Its IUPAC name is 2-chloro-N-[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]benzamide.
| Compound Name | 2-chloro-N-[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 113013137 |
| Molecular Formula | C21H18ClN3O |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-chloro-N-[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc3C2)nc1)c1ccccc1Cl |
| InChI | InChI=1S/C21H18ClN3O/c22-19-8-4-3-7-18(19)21(26)24-17-9-10-20(23-13-17)25-12-11-15-5-1-2-6-16(15)14-25/h1-10,13H,11-12,14H2,(H,24,26) |
| InChIKey | BUUCNBZEIRBFMS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |