C33H38FN4OSi — CID 66851155
CID 66851155 (PubChem CID 66851155) has the molecular formula C33H38FN4OSi and a molecular weight of 553.78 g/mol.
| Compound Name | CID 66851155 |
|---|---|
| PubChem CID | 66851155 |
| Molecular Formula | C33H38FN4OSi |
| Molecular Weight | 553.78 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | — |
| SMILES | C[Si](C)c1c(C(=O)Nc2ccc(N3CCCC3)nc2)n(Cc2cccc(F)c2)c2ccc(C3CCCCC3)cc12 |
| InChI | InChI=1S/C33H38FN4OSi/c1-40(2)32-28-20-25(24-10-4-3-5-11-24)13-15-29(28)38(22-23-9-8-12-26(34)19-23)31(32)33(39)36-27-14-16-30(35-21-27)37-17-6-7-18-37/h8-9,12-16,19-21,24H,3-7,10-11,17-18,22H2,1-2H3,(H,36,39) |
| InChIKey | VSYSRQVQXZODFK-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.78 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|