C20H24FN5O2 — CID 48795694
1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-(6-morpholin-4-yl-3-pyridinyl)urea (PubChem CID 48795694) has the molecular formula C20H24FN5O2 and a molecular weight of 385.44 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-(6-morpholin-4-yl-3-pyridinyl)urea.
| Compound Name | 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-(6-morpholin-4-yl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 48795694 |
| Molecular Formula | C20H24FN5O2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 1-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3-(6-morpholin-4-yl-3-pyridinyl)urea |
| SMILES | O=C(Nc1ccc(N2CCOCC2)nc1)Nc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C20H24FN5O2/c21-17-13-15(3-5-18(17)25-7-1-2-8-25)23-20(27)24-16-4-6-19(22-14-16)26-9-11-28-12-10-26/h3-6,13-14H,1-2,7-12H2,(H2,23,24,27) |
| InChIKey | WPESVVBGBWGFBQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|