C23H29FN4O2 — CID 11718559
1-(3-fluoro-4-piperidin-1-ylphenyl)-3-[4-(morpholin-4-ylmethyl)phenyl]urea (PubChem CID 11718559) has the molecular formula C23H29FN4O2 and a molecular weight of 412.51 g/mol. Its IUPAC name is 1-(3-fluoro-4-piperidin-1-ylphenyl)-3-[4-(morpholin-4-ylmethyl)phenyl]urea.
| Compound Name | 1-(3-fluoro-4-piperidin-1-ylphenyl)-3-[4-(morpholin-4-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 11718559 |
| Molecular Formula | C23H29FN4O2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 1-(3-fluoro-4-piperidin-1-ylphenyl)-3-[4-(morpholin-4-ylmethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(CN2CCOCC2)cc1)Nc1ccc(N2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C23H29FN4O2/c24-21-16-20(8-9-22(21)28-10-2-1-3-11-28)26-23(29)25-19-6-4-18(5-7-19)17-27-12-14-30-15-13-27/h4-9,16H,1-3,10-15,17H2,(H2,25,26,29) |
| InChIKey | LXFVOULRFBVUGC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|