C42H45ClFN7O4 — CID 69346336
1-(4-chlorophenyl)-3-(4-pyridin-3-ylphenyl)urea;1-(3-fluoro-4-piperidin-1-ylphenyl)-3-[3-(2-morpholin-4-ylethoxy)phenyl]urea (PubChem CID 69346336) has the molecular formula C42H45ClFN7O4 and a molecular weight of 766.32 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(4-pyridin-3-ylphenyl)urea;1-(3-fluoro-4-piperidin-1-ylphenyl)-3-[3-(2-morpholin-4-ylethoxy)phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-(4-pyridin-3-ylphenyl)urea;1-(3-fluoro-4-piperidin-1-ylphenyl)-3-[3-(2-morpholin-4-ylethoxy)phenyl]urea |
|---|---|
| PubChem CID | 69346336 |
| Molecular Formula | C42H45ClFN7O4 |
| Molecular Weight | 766.32 g/mol |
| Exact Mass | 765.32 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(4-pyridin-3-ylphenyl)urea;1-(3-fluoro-4-piperidin-1-ylphenyl)-3-[3-(2-morpholin-4-ylethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1ccc(-c2cccnc2)cc1.O=C(Nc1cccc(OCCN2CCOCC2)c1)Nc1ccc(N2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C24H31FN4O3.C18H14ClN3O/c25-22-18-20(7-8-23(22)29-9-2-1-3-10-29)27-24(30)26-19-5-4-6-21(17-19)32-16-13-28-11-14-31-15-12-28;19-15-5-9-17(10-6-15)22-18(23)21-16-7-3-13(4-8-16)14-2-1-11-20-12-14/h4-8,17-18H,1-3,9-16H2,(H2,26,27,30);1-12H,(H2,21,22,23) |
| InChIKey | FADPJFJNOLQHKH-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.32 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|