C26H29F2N5O — CID 59840335
1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-3-(4-pyridin-3-ylphenyl)urea (PubChem CID 59840335) has the molecular formula C26H29F2N5O and a molecular weight of 465.55 g/mol. Its IUPAC name is 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-3-(4-pyridin-3-ylphenyl)urea.
| Compound Name | 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-3-(4-pyridin-3-ylphenyl)urea |
|---|---|
| PubChem CID | 59840335 |
| Molecular Formula | C26H29F2N5O |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-3-(4-pyridin-3-ylphenyl)urea |
| SMILES | O=C(NCCCCN1CCN(c2ccc(F)cc2F)CC1)Nc1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C26H29F2N5O/c27-22-7-10-25(24(28)18-22)33-16-14-32(15-17-33)13-2-1-12-30-26(34)31-23-8-5-20(6-9-23)21-4-3-11-29-19-21/h3-11,18-19H,1-2,12-17H2,(H2,30,31,34) |
| InChIKey | STAXIOANGTVLOF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|