C25H31FN4O2S — CID 59121849
1-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]-3-(3-methoxyphenyl)urea (PubChem CID 59121849) has the molecular formula C25H31FN4O2S and a molecular weight of 470.61 g/mol. Its IUPAC name is 1-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 59121849 |
| Molecular Formula | C25H31FN4O2S |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)NCCCCN2CCCN(c3csc4cc(F)ccc34)CC2)c1 |
| InChI | InChI=1S/C25H31FN4O2S/c1-32-21-7-4-6-20(17-21)28-25(31)27-10-2-3-11-29-12-5-13-30(15-14-29)23-18-33-24-16-19(26)8-9-22(23)24/h4,6-9,16-18H,2-3,5,10-15H2,1H3,(H2,27,28,31) |
| InChIKey | XWGPALJNIRGBHV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|