C24H28ClFN4OS — CID 59121884
1-(3-chlorophenyl)-3-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]urea (PubChem CID 59121884) has the molecular formula C24H28ClFN4OS and a molecular weight of 475.03 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]urea |
|---|---|
| PubChem CID | 59121884 |
| Molecular Formula | C24H28ClFN4OS |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]urea |
| SMILES | O=C(NCCCCN1CCCN(c2csc3cc(F)ccc23)CC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H28ClFN4OS/c25-18-5-3-6-20(15-18)28-24(31)27-9-1-2-10-29-11-4-12-30(14-13-29)22-17-32-23-16-19(26)7-8-21(22)23/h3,5-8,15-17H,1-2,4,9-14H2,(H2,27,28,31) |
| InChIKey | QOAIJLAKUMQPAM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|