C27H35FN4O4S — CID 59121850
1-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 59121850) has the molecular formula C27H35FN4O4S and a molecular weight of 530.67 g/mol. Its IUPAC name is 1-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 59121850 |
| Molecular Formula | C27H35FN4O4S |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | 1-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NCCCCN2CCCN(c3csc4cc(F)ccc34)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C27H35FN4O4S/c1-34-23-16-20(17-24(35-2)26(23)36-3)30-27(33)29-9-4-5-10-31-11-6-12-32(14-13-31)22-18-37-25-15-19(28)7-8-21(22)25/h7-8,15-18H,4-6,9-14H2,1-3H3,(H2,29,30,33) |
| InChIKey | CCLUAJPGBWZWLS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 75.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|