C22H30FN3OS — CID 58817755
4-[4-(6-fluoro-1-benzothiophen-3-yl)piperazin-1-yl]-1-(3-methylpiperidin-1-yl)butan-1-one (PubChem CID 58817755) has the molecular formula C22H30FN3OS and a molecular weight of 403.57 g/mol. Its IUPAC name is 4-[4-(6-fluoro-1-benzothiophen-3-yl)piperazin-1-yl]-1-(3-methylpiperidin-1-yl)butan-1-one.
| Compound Name | 4-[4-(6-fluoro-1-benzothiophen-3-yl)piperazin-1-yl]-1-(3-methylpiperidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 58817755 |
| Molecular Formula | C22H30FN3OS |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 4-[4-(6-fluoro-1-benzothiophen-3-yl)piperazin-1-yl]-1-(3-methylpiperidin-1-yl)butan-1-one |
| SMILES | CC1CCCN(C(=O)CCCN2CCN(c3csc4cc(F)ccc34)CC2)C1 |
| InChI | InChI=1S/C22H30FN3OS/c1-17-4-2-9-26(15-17)22(27)5-3-8-24-10-12-25(13-11-24)20-16-28-21-14-18(23)6-7-19(20)21/h6-7,14,16-17H,2-5,8-13,15H2,1H3 |
| InChIKey | YQLWJBJDPWAWIL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |