C23H30F3N3OS — CID 58817663
N-cyclohexyl-4-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]piperazin-1-yl]butanamide (PubChem CID 58817663) has the molecular formula C23H30F3N3OS and a molecular weight of 453.57 g/mol. Its IUPAC name is N-cyclohexyl-4-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]piperazin-1-yl]butanamide.
| Compound Name | N-cyclohexyl-4-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]piperazin-1-yl]butanamide |
|---|---|
| PubChem CID | 58817663 |
| Molecular Formula | C23H30F3N3OS |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-cyclohexyl-4-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]piperazin-1-yl]butanamide |
| SMILES | O=C(CCCN1CCN(c2csc3cc(C(F)(F)F)ccc23)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C23H30F3N3OS/c24-23(25,26)17-8-9-19-20(16-31-21(19)15-17)29-13-11-28(12-14-29)10-4-7-22(30)27-18-5-2-1-3-6-18/h8-9,15-16,18H,1-7,10-14H2,(H,27,30) |
| InChIKey | FGXXXPZLBZJPOZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |