C19H24F3N3OS — CID 23136822
6-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]piperazin-1-yl]hexanamide (PubChem CID 23136822) has the molecular formula C19H24F3N3OS and a molecular weight of 399.48 g/mol. Its IUPAC name is 6-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]piperazin-1-yl]hexanamide.
| Compound Name | 6-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]piperazin-1-yl]hexanamide |
|---|---|
| PubChem CID | 23136822 |
| Molecular Formula | C19H24F3N3OS |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 6-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]piperazin-1-yl]hexanamide |
| SMILES | NC(=O)CCCCCN1CCN(c2csc3cc(C(F)(F)F)ccc23)CC1 |
| InChI | InChI=1S/C19H24F3N3OS/c20-19(21,22)14-5-6-15-16(13-27-17(15)12-14)25-10-8-24(9-11-25)7-3-1-2-4-18(23)26/h5-6,12-13H,1-4,7-11H2,(H2,23,26) |
| InChIKey | RXQVGNVEHKZJLT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|