C24H27Cl2FN4OS — CID 59121817
1-(3,5-dichlorophenyl)-3-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]urea (PubChem CID 59121817) has the molecular formula C24H27Cl2FN4OS and a molecular weight of 509.48 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]urea |
|---|---|
| PubChem CID | 59121817 |
| Molecular Formula | C24H27Cl2FN4OS |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[4-[4-(6-fluoro-1-benzothiophen-3-yl)-1,4-diazepan-1-yl]butyl]urea |
| SMILES | O=C(NCCCCN1CCCN(c2csc3cc(F)ccc23)CC1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C24H27Cl2FN4OS/c25-17-12-18(26)14-20(13-17)29-24(32)28-6-1-2-7-30-8-3-9-31(11-10-30)22-16-33-23-15-19(27)4-5-21(22)23/h4-5,12-16H,1-3,6-11H2,(H2,28,29,32) |
| InChIKey | SRAGCLFHPYTNQG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|