C23H26F3N3O2S — CID 142164267
(2Z)-4-methylpenta-2,4-dienoic acid;4-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]piperazin-1-yl]butanenitrile (PubChem CID 142164267) has the molecular formula C23H26F3N3O2S and a molecular weight of 465.54 g/mol. Its IUPAC name is (2Z)-4-methylpenta-2,4-dienoic acid;4-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]piperazin-1-yl]butanenitrile.
| Compound Name | (2Z)-4-methylpenta-2,4-dienoic acid;4-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]piperazin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 142164267 |
| Molecular Formula | C23H26F3N3O2S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | (2Z)-4-methylpenta-2,4-dienoic acid;4-[4-[6-(trifluoromethyl)-1-benzothiophen-3-yl]piperazin-1-yl]butanenitrile |
| SMILES | C=C(C)/C=C\C(=O)O.N#CCCCN1CCN(c2csc3cc(C(F)(F)F)ccc23)CC1 |
| InChI | InChI=1S/C17H18F3N3S.C6H8O2/c18-17(19,20)13-3-4-14-15(12-24-16(14)11-13)23-9-7-22(8-10-23)6-2-1-5-21;1-5(2)3-4-6(7)8/h3-4,11-12H,1-2,6-10H2;3-4H,1H2,2H3,(H,7,8)/b;4-3- |
| InChIKey | QWQSNGJWEOGGAY-QGAMPUOQSA-N |
| XLogP | 5.55 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|