C28H37N3O5S2 — CID 173285807
3-[4-[4-(1-benzothiophen-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.5]decan-4-one;but-2-enedioic acid (PubChem CID 173285807) has the molecular formula C28H37N3O5S2 and a molecular weight of 559.75 g/mol. Its IUPAC name is 3-[4-[4-(1-benzothiophen-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.5]decan-4-one;but-2-enedioic acid.
| Compound Name | 3-[4-[4-(1-benzothiophen-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.5]decan-4-one;but-2-enedioic acid |
|---|---|
| PubChem CID | 173285807 |
| Molecular Formula | C28H37N3O5S2 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | 3-[4-[4-(1-benzothiophen-3-yl)piperazin-1-yl]butyl]-1-thia-3-azaspiro[4.5]decan-4-one;but-2-enedioic acid |
| SMILES | O=C(O)C=CC(=O)O.O=C1N(CCCCN2CCN(c3csc4ccccc34)CC2)CSC12CCCCC2 |
| InChI | InChI=1S/C24H33N3OS2.C4H4O4/c28-23-24(10-4-1-5-11-24)30-19-27(23)13-7-6-12-25-14-16-26(17-15-25)21-18-29-22-9-3-2-8-20(21)22;5-3(6)1-2-4(7)8/h2-3,8-9,18H,1,4-7,10-17,19H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | OOBDEXVZFWSJQR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|