C24H31N5O5S — CID 67755556
but-2-enedioic acid;5-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one (PubChem CID 67755556) has the molecular formula C24H31N5O5S and a molecular weight of 501.61 g/mol. Its IUPAC name is but-2-enedioic acid;5-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one.
| Compound Name | but-2-enedioic acid;5-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one |
|---|---|
| PubChem CID | 67755556 |
| Molecular Formula | C24H31N5O5S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | but-2-enedioic acid;5-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one |
| SMILES | O=C(O)C=CC(=O)O.O=C1c2ccsc2CCCN1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H27N5OS.C4H4O4/c26-19-17-6-16-27-18(17)5-3-11-24(19)10-2-1-9-23-12-14-25(15-13-23)20-21-7-4-8-22-20;5-3(6)1-2-4(7)8/h4,6-8,16H,1-3,5,9-15H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | UCTIDWXRBTWVBZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|