C19H24BrN5OS2 — CID 19881101
7-bromo-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one (PubChem CID 19881101) has the molecular formula C19H24BrN5OS2 and a molecular weight of 482.47 g/mol. Its IUPAC name is 7-bromo-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one.
| Compound Name | 7-bromo-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 19881101 |
| Molecular Formula | C19H24BrN5OS2 |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 7-bromo-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one |
| SMILES | O=C1c2cc(Br)sc2SCCN1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H24BrN5OS2/c20-16-14-15-17(26)24(12-13-27-18(15)28-16)7-2-1-6-23-8-10-25(11-9-23)19-21-4-3-5-22-19/h3-5,14H,1-2,6-13H2 |
| InChIKey | KTAPSXHRJPQRGG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|