C24H31N5O5S2 — CID 67755371
(E)-but-2-enedioic acid;7-methyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one (PubChem CID 67755371) has the molecular formula C24H31N5O5S2 and a molecular weight of 533.68 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;7-methyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one.
| Compound Name | (E)-but-2-enedioic acid;7-methyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 67755371 |
| Molecular Formula | C24H31N5O5S2 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | (E)-but-2-enedioic acid;7-methyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one |
| SMILES | Cc1cc2c(s1)SCCN(CCCCN1CCN(c3ncccn3)CC1)C2=O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H27N5OS2.C4H4O4/c1-16-15-17-18(26)24(13-14-27-19(17)28-16)8-3-2-7-23-9-11-25(12-10-23)20-21-5-4-6-22-20;5-3(6)1-2-4(7)8/h4-6,15H,2-3,7-14H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | KAJVTAGJAWYGLW-WLHGVMLRSA-N |
| XLogP | 2.71 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|