C27H37N5O5S — CID 67755572
(E)-but-2-enedioic acid;2-propyl-5-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one (PubChem CID 67755572) has the molecular formula C27H37N5O5S and a molecular weight of 543.69 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-propyl-5-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one.
| Compound Name | (E)-but-2-enedioic acid;2-propyl-5-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one |
|---|---|
| PubChem CID | 67755572 |
| Molecular Formula | C27H37N5O5S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | (E)-but-2-enedioic acid;2-propyl-5-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one |
| SMILES | CCCc1cc2c(s1)CCCN(CCCCN1CCN(c3ncccn3)CC1)C2=O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H33N5OS.C4H4O4/c1-2-7-19-18-20-21(30-19)8-5-13-27(22(20)29)12-4-3-11-26-14-16-28(17-15-26)23-24-9-6-10-25-23;5-3(6)1-2-4(7)8/h6,9-10,18H,2-5,7-8,11-17H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | MJIGOFQODNYZGP-WLHGVMLRSA-N |
| XLogP | 3.19 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|