C22H31N5OS — CID 19881106
2-ethyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-b]azepin-5-one (PubChem CID 19881106) has the molecular formula C22H31N5OS and a molecular weight of 413.59 g/mol. Its IUPAC name is 2-ethyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-b]azepin-5-one.
| Compound Name | 2-ethyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-b]azepin-5-one |
|---|---|
| PubChem CID | 19881106 |
| Molecular Formula | C22H31N5OS |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 2-ethyl-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7,8-dihydro-6H-thieno[3,2-b]azepin-5-one |
| SMILES | CCc1cc2c(s1)CCCC(=O)N2CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H31N5OS/c1-2-18-17-19-20(29-18)7-5-8-21(28)27(19)12-4-3-11-25-13-15-26(16-14-25)22-23-9-6-10-24-22/h6,9-10,17H,2-5,7-8,11-16H2,1H3 |
| InChIKey | ZYKMUYYDFLUVDL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|