C16H25N5OS — CID 14856172
2-methyl-3-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,3-thiazolidin-4-one (PubChem CID 14856172) has the molecular formula C16H25N5OS and a molecular weight of 335.48 g/mol. Its IUPAC name is 2-methyl-3-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-methyl-3-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 14856172 |
| Molecular Formula | C16H25N5OS |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-methyl-3-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,3-thiazolidin-4-one |
| SMILES | CC1SCC(=O)N1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H25N5OS/c1-14-21(15(22)13-23-14)8-3-2-7-19-9-11-20(12-10-19)16-17-5-4-6-18-16/h4-6,14H,2-3,7-13H2,1H3 |
| InChIKey | VMPXRJJAAPLNPZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|