C16H26N6OS — CID 57319061
5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one (PubChem CID 57319061) has the molecular formula C16H26N6OS and a molecular weight of 350.49 g/mol. Its IUPAC name is 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one.
| Compound Name | 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one |
|---|---|
| PubChem CID | 57319061 |
| Molecular Formula | C16H26N6OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one |
| SMILES | CC1CC(=O)N(CCCCN2CCN(c3ncccn3)CC2)SN1 |
| InChI | InChI=1S/C16H26N6OS/c1-14-13-15(23)22(24-19-14)8-3-2-7-20-9-11-21(12-10-20)16-17-5-4-6-18-16/h4-6,14,19H,2-3,7-13H2,1H3 |
| InChIKey | OCRYVRNRHXBOCV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|