About 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one
5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one (PubChem CID 57319061) has the molecular formula C16H26N6OS
and a molecular weight of 350.49 g/mol. Its IUPAC name is 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one.
Molecular Properties
| Compound Name | 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one |
| PubChem CID | 57319061 |
| Molecular Formula | C16H26N6OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one |
| SMILES | CC1CC(=O)N(CCCCN2CCN(c3ncccn3)CC2)SN1 |
| InChI | InChI=1S/C16H26N6OS/c1-14-13-15(23)22(24-19-14)8-3-2-7-20-9-11-21(12-10-20)16-17-5-4-6-18-16/h4-6,14,19H,2-3,7-13H2,1H3 |
| InChIKey | OCRYVRNRHXBOCV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one?
The IUPAC name of 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one (CID 57319061) is 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one.
What is the SMILES notation for 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one?
The canonical SMILES for 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one is CC1CC(=O)N(CCCCN2CCN(c3ncccn3)CC2)SN1.
What is the InChIKey of 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one?
The InChIKey is OCRYVRNRHXBOCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N6OS/c1-14-13-15(23)22(24-19-14)8-3-2-7-20-9-11-21(12-10-20)16-17-5-4-6-18-16/h4-6,14,19H,2-3,7-13H2,1H3.
What are the key properties of 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one?
5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one has a molecular weight of 350.49 g/mol, XLogP of 1.15, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2,6-thiadiazinan-3-one is sourced from PubChem (CID 57319061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).