C21H26N6O2S — CID 19023440
6-methylsulfanyl-3-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1H-quinazoline-2,4-dione (PubChem CID 19023440) has the molecular formula C21H26N6O2S and a molecular weight of 426.55 g/mol. Its IUPAC name is 6-methylsulfanyl-3-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1H-quinazoline-2,4-dione.
| Compound Name | 6-methylsulfanyl-3-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 19023440 |
| Molecular Formula | C21H26N6O2S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 6-methylsulfanyl-3-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1H-quinazoline-2,4-dione |
| SMILES | CSc1ccc2[nH]c(=O)n(CCCCN3CCN(c4ncccn4)CC3)c(=O)c2c1 |
| InChI | InChI=1S/C21H26N6O2S/c1-30-16-5-6-18-17(15-16)19(28)27(21(29)24-18)10-3-2-9-25-11-13-26(14-12-25)20-22-7-4-8-23-20/h4-8,15H,2-3,9-14H2,1H3,(H,24,29) |
| InChIKey | WRVCPVQJSZFHHV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|