C19H23N7O2 — CID 19023409
6-amino-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1H-quinazoline-2,4-dione (PubChem CID 19023409) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 6-amino-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1H-quinazoline-2,4-dione.
| Compound Name | 6-amino-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 19023409 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 6-amino-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1H-quinazoline-2,4-dione |
| SMILES | Nc1ccc2[nH]c(=O)n(CCCN3CCN(c4ncccn4)CC3)c(=O)c2c1 |
| InChI | InChI=1S/C19H23N7O2/c20-14-3-4-16-15(13-14)17(27)26(19(28)23-16)8-2-7-24-9-11-25(12-10-24)18-21-5-1-6-22-18/h1,3-6,13H,2,7-12,20H2,(H,23,28) |
| InChIKey | KSMBCDQCGGAMFM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|